Benzenesulfonamide, 4-(cyanomethyl)- (9CI)
Benzenesulfonamide, 4-(cyanomethyl)- (9CI) structure
|
Common Name | Benzenesulfonamide, 4-(cyanomethyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3665-08-5 | Molecular Weight | 196.22600 | |
| Density | 1.357g/cm3 | Boiling Point | 418.5ºC at 760mmHg | |
| Molecular Formula | C8H8N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(cyanomethyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 418.5ºC at 760mmHg |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.22600 |
| Flash Point | 206.9ºC |
| Exact Mass | 196.03100 |
| PSA | 92.33000 |
| LogP | 2.18118 |
| Index of Refraction | 1.584 |
| InChIKey | KMDZAPVMOLFJLY-UHFFFAOYSA-N |
| SMILES | N#CCc1ccc(S(N)(=O)=O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2935009090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:35303-76-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenesulfonamide,p-(cyanomethyl) |
| 4-Cyanmethyl-benzolsulfonamid |
| p-(Cyanomethyl)benzenesulfonamide |
| 4-cyanomethyl-benzenesulfonic acid amide |
| 4-Sulfamoyl-phenylacetonitril |
| 4-Cyanmethyl-benzolsulfonsaeure-amid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-(cyanomethyl)benzenesulfonamide? |
| A: Polar surface area (PSA) of 4-(cyanomethyl)benzenesulfonamide is 92.33000. |
| Q: What is the InChIKey of 4-(cyanomethyl)benzenesulfonamide? |
| A: InChIKey of 4-(cyanomethyl)benzenesulfonamide is KMDZAPVMOLFJLY-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-(cyanomethyl)benzenesulfonamide? |
| A: LogP of 4-(cyanomethyl)benzenesulfonamide is 2.18118. |
| Q: What English synonyms does 4-(cyanomethyl)benzenesulfonamide have? |
| A: English synonyms of 4-(cyanomethyl)benzenesulfonamide: Benzenesulfonamide,p-(cyanomethyl), 4-Cyanmethyl-benzolsulfonamid, p-(Cyanomethyl)benzenesulfonamide, 4-cyanomethyl-benzenesulfonic acid amide, 4-Sulfamoyl-phenylacetonitril, 4-Cyanmethyl-benzolsulfonsaeure-amid. |
| Q: What is the boiling point of 4-(cyanomethyl)benzenesulfonamide? |
| A: Boiling point of 4-(cyanomethyl)benzenesulfonamide is 418.5ºC at 760mmHg. |
| Q: What is the molecular weight of 4-(cyanomethyl)benzenesulfonamide? |
| A: Molecular weight of 4-(cyanomethyl)benzenesulfonamide is 196.22600. |
| Q: What is the molecular formula of 4-(cyanomethyl)benzenesulfonamide? |
| A: Molecular formula of 4-(cyanomethyl)benzenesulfonamide is C8H8N2O2S. |
| Q: What is the CAS number of 4-(cyanomethyl)benzenesulfonamide? |
| A: CAS number of 4-(cyanomethyl)benzenesulfonamide is 3665-08-5. |
| Q: What is the SMILES notation of 4-(cyanomethyl)benzenesulfonamide? |
| A: SMILES notation of 4-(cyanomethyl)benzenesulfonamide is N#CCc1ccc(S(N)(=O)=O)cc1. |
| Q: What is the English name of 4-(cyanomethyl)benzenesulfonamide? |
| A: The English name of 4-(cyanomethyl)benzenesulfonamide is 4-(cyanomethyl)benzenesulfonamide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |