1-methoxy-4-[1-(4-methoxyphenyl)-2-nitroethenyl]benzene structure
|
Common Name | 1-methoxy-4-[1-(4-methoxyphenyl)-2-nitroethenyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 36697-31-1 | Molecular Weight | 285.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methoxy-4-[1-(4-methoxyphenyl)-2-nitroethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15NO4 |
|---|---|
| Molecular Weight | 285.29500 |
| Exact Mass | 285.10000 |
| PSA | 64.28000 |
| LogP | 3.89290 |
| InChIKey | KFFANRUOKOLBPN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=C[N+](=O)[O-])c2ccc(OC)cc2)cc1 |
|
~55%
1-methoxy-4-[1-... CAS#:36697-31-1 |
| Literature: Tyrkov Russian Journal of Organic Chemistry, 2003 , vol. 39, # 6 p. 890 - 892 |
|
~79%
1-methoxy-4-[1-... CAS#:36697-31-1 |
| Literature: Tadros, Wadie; Awad, Sami B.; Sakla, Alfy B.; Abdul-Malik, Nadia F.; Armanious, Emili R. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 3 p. 199 - 202 |
|
~48%
1-methoxy-4-[1-... CAS#:36697-31-1 |
| Literature: Pak; Tyrkov Russian Journal of Organic Chemistry, 2011 , vol. 47, # 9 p. 1284 - 1286 |
|
~%
1-methoxy-4-[1-... CAS#:36697-31-1 |
|
Literature: Bulich,J. Diss. |
| 1,1-Dianisyl-2-nitroethylen |
| 1,1-bis-(4-methoxy-phenyl)-2-nitro-ethene |
| 1,1-Bis-(4-methoxy-phenyl)-2-nitro-aethen |
| 2,2-di(4-methoxyphenyl)-1-nitroethylene |
| 1,1'-(2-nitroethene-1,1-diyl)bis(4-methoxybenzene) |
| 2,2-bis-(p-methoxyphenyl)-1-nitroethylene |
| (2,2-Bis(4-methoxyphenyl)vinyl)(hydroxy)azane oxide |
| 2-Nitro-1.1-bis-(4-methoxy-phenyl)-aethylen |
| Benzene,1,1'-(nitroethenylidene)bis[4-methoxy |