methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate structure
|
Common Name | methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 36699-87-3 | Molecular Weight | 198.21600 | |
| Density | 1.188g/cm3 | Boiling Point | 299.7ºC at 760 mmHg | |
| Molecular Formula | C10H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.7ºC | |
| Name | methyl 2-hydroxy-3,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 299.7ºC at 760 mmHg |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.21600 |
| Flash Point | 113.7ºC |
| Exact Mass | 198.08900 |
| PSA | 63.60000 |
| LogP | 1.21650 |
| Index of Refraction | 1.503 |
| InChIKey | GRUZVKBJCPADAL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C(O)=C(C)C(=O)CC1C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-hydroxy-3,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate |
| methyl 2-hydroxy-3,6-dimethyl-4-oxo-cyclohex-2-ene-1-carboxylate |
| Methyl-3,6-dimethyldihydroresorcylat |
| EINECS 253-159-5 |