1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane
1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane structure
|
Common Name | 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane | ||
|---|---|---|---|---|
| CAS Number | 367-53-3 | Molecular Weight | 234.06300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H3F9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H3F9 |
|---|---|
| Molecular Weight | 234.06300 |
| Exact Mass | 234.00900 |
| LogP | 3.67960 |
| InChIKey | ZLLFAXODNBYNCI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CC(C(F)(F)F)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2903399090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,1,4,4,4-HEXAFLUORO-2-(TRIFLUOROMETHYL)-BUTANE |
| 1,1,1,4,4,4-Hexafluoro-2-(trifluoromethyl)butane |
| 1,1,1,4,4,4-hexafluoro-2-trifluoromethyl-butane |
| 1,1,2-tris-(trifluormethyl)ethan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane? |
| A: InChIKey of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane is ZLLFAXODNBYNCI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane? |
| A: CAS number of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane is 367-53-3. |
| Q: What English synonyms does 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane have? |
| A: English synonyms of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane: 1,1,1,4,4,4-HEXAFLUORO-2-(TRIFLUOROMETHYL)-BUTANE, 1,1,1,4,4,4-Hexafluoro-2-(trifluoromethyl)butane, 1,1,1,4,4,4-hexafluoro-2-trifluoromethyl-butane, 1,1,2-tris-(trifluormethyl)ethan. |
| Q: What is the SMILES notation of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane? |
| A: SMILES notation of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane is FC(F)(F)CC(C(F)(F)F)C(F)(F)F. |
| Q: What is the Chinese name of 367-53-3? |
| A: Chinese name of 367-53-3 is 367-53-3. |
| Q: What is the English name of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane? |
| A: The English name of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane is 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane. |
| Q: What is the molecular weight of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane? |
| A: Molecular weight of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane is 234.06300. |
| Q: What is the molecular formula of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane? |
| A: Molecular formula of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane is C5H3F9. |
| Q: What is the LogP of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane? |
| A: LogP of 1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butane is 3.67960. |