2-(2,6-dimethyl-2H-pyridin-1-yl)-1-(4-fluorophenyl)ethanone structure
|
Common Name | 2-(2,6-dimethyl-2H-pyridin-1-yl)-1-(4-fluorophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 367-76-0 | Molecular Weight | 324.18800 | |
| Density | 1.098g/cm3 | Boiling Point | 383.6ºC at 760 mmHg | |
| Molecular Formula | C15H15BrFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8ºC | |
| Name | 2-(2,6-dimethylpyridin-1-ium-1-yl)-1-(4-fluorophenyl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 383.6ºC at 760 mmHg |
| Molecular Formula | C15H15BrFNO |
| Molecular Weight | 324.18800 |
| Flash Point | 185.8ºC |
| Exact Mass | 323.03200 |
| PSA | 20.95000 |
| Index of Refraction | 1.535 |
| InChIKey | CDIOLLQJQYMNHY-UHFFFAOYSA-M |
| SMILES | Cc1cccc(C)[n+]1CC(=O)c1ccc(F)cc1.[Br-] |
|
~%
2-(2,6-dimethyl... CAS#:367-76-0 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 3960 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-fluoro-phenacyl)-2,6-dimethyl-pyridinium,bromide |
| 1-(4-Fluor-phenacyl)-2,6-dimethyl-pyridinium,Bromid |