1,4-dibromo-2,5-bis(dibromomethyl)benzene structure
|
Common Name | 1,4-dibromo-2,5-bis(dibromomethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 36711-69-0 | Molecular Weight | 579.54100 | |
| Density | 2.777g/cm3 | Boiling Point | 456.3ºC at 760mmHg | |
| Molecular Formula | C8H4Br6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.7ºC | |
| Name | 1,4-dibromo-2,5-bis(dibromomethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.777g/cm3 |
|---|---|
| Boiling Point | 456.3ºC at 760mmHg |
| Molecular Formula | C8H4Br6 |
| Molecular Weight | 579.54100 |
| Flash Point | 221.7ºC |
| Exact Mass | 573.54100 |
| LogP | 6.78840 |
| Index of Refraction | 1.719 |
| InChIKey | KLEOTAJNEAAHOP-UHFFFAOYSA-N |
| SMILES | Brc1cc(C(Br)Br)c(Br)cc1C(Br)Br |
| HS Code | 2903999090 |
|---|
|
~%
1,4-dibromo-2,5... CAS#:36711-69-0 |
| Literature: Ruggli; Brandt Helvetica Chimica Acta, 1944 , vol. 27, p. 274,290 |
|
~%
1,4-dibromo-2,5... CAS#:36711-69-0 |
| Literature: Ruggli; Brandt Helvetica Chimica Acta, 1944 , vol. 27, p. 274,290 |
|
~%
1,4-dibromo-2,5... CAS#:36711-69-0 |
| Literature: Ruggli; Brandt Helvetica Chimica Acta, 1944 , vol. 27, p. 274,290 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 253-165-8 |
| 1,4-dibromo-2,5-bis-dibromomethyl-benzene |
| 1,4-Dibrom-2,5-bis-dibrommethyl-benzol |