4-(p-methylphenyl)cyclohex-3-en-1-one
4-(p-methylphenyl)cyclohex-3-en-1-one structure
|
Common Name | 4-(p-methylphenyl)cyclohex-3-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 36716-74-2 | Molecular Weight | 186.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(p-methylphenyl)cyclohex-3-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14O |
|---|---|
| Molecular Weight | 186.25000 |
| Exact Mass | 186.10400 |
| PSA | 17.07000 |
| LogP | 3.13140 |
| InChIKey | IQZARCGBOZEPSM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2=CCC(=O)CC2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:40503-90-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(p-methylphenyl)-3-cyclohexen-1-one |
| 4-(p-Methylphenyl)-3-cyclohexen-1-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: The English name of 4-(p-methylphenyl)cyclohex-3-en-1-one is 4-(p-methylphenyl)cyclohex-3-en-1-one. |
| Q: What is the InChIKey of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: InChIKey of 4-(p-methylphenyl)cyclohex-3-en-1-one is IQZARCGBOZEPSM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: CAS number of 4-(p-methylphenyl)cyclohex-3-en-1-one is 36716-74-2. |
| Q: What is the Chinese name of 36716-74-2? |
| A: Chinese name of 36716-74-2 is 36716-74-2. |
| Q: What are the downstream products of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: Related downstream products(CAS) of 4-(p-methylphenyl)cyclohex-3-en-1-one: 40503-90-0. |
| Q: What is the polar surface area (PSA) of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: Polar surface area (PSA) of 4-(p-methylphenyl)cyclohex-3-en-1-one is 17.07000. |
| Q: What English synonyms does 4-(p-methylphenyl)cyclohex-3-en-1-one have? |
| A: English synonyms of 4-(p-methylphenyl)cyclohex-3-en-1-one: 4-(p-methylphenyl)-3-cyclohexen-1-one, 4-(p-Methylphenyl)-3-cyclohexen-1-ol. |
| Q: What is the molecular formula of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: Molecular formula of 4-(p-methylphenyl)cyclohex-3-en-1-one is C13H14O. |
| Q: What is the SMILES notation of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: SMILES notation of 4-(p-methylphenyl)cyclohex-3-en-1-one is Cc1ccc(C2=CCC(=O)CC2)cc1. |
| Q: What is the molecular weight of 4-(p-methylphenyl)cyclohex-3-en-1-one? |
| A: Molecular weight of 4-(p-methylphenyl)cyclohex-3-en-1-one is 186.25000. |