(4-nitrophenyl) 3-methylbenzoate structure
|
Common Name | (4-nitrophenyl) 3-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 36718-84-0 | Molecular Weight | 257.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-nitrophenyl) 3-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11NO4 |
|---|---|
| Molecular Weight | 257.24100 |
| Exact Mass | 257.06900 |
| PSA | 72.12000 |
| LogP | 3.64560 |
| InChIKey | CWXGZYLOHXHWAL-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)Oc2ccc([N+](=O)[O-])cc2)c1 |
|
~%
(4-nitrophenyl)... CAS#:36718-84-0 |
| Literature: Um, Ik-Hwan; Lee, Ji-Youn; Fujio, Mizue; Tsuno, Yuho Organic and Biomolecular Chemistry, 2006 , vol. 4, # 15 p. 2979 - 2985 |
|
~%
(4-nitrophenyl)... CAS#:36718-84-0 |
| Literature: Goossen, Lukas J.; Paetzold Angewandte Chemie - International Edition, 2002 , vol. 41, # 7 p. 1237 - 1241 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
|
Name: Binding affinity to chymotrypsin (unknown origin) assessed as acetylation at pH 7
Source: ChEMBL
Target: N/A
External Id: CHEMBL3284066
|
| m-Toluic acid,4-nitrophenyl ester |
| 4-nitrophenyl 3-methylbenzoate |
| m-Toluylic acid,4-nitrophenyl ester |
| p-Nitrophenyl-m-methylbenzoat |