2-methyl-N-(2-methylpropyl)-N-phenyldiazenyl-propan-1-amine structure
|
Common Name | 2-methyl-N-(2-methylpropyl)-N-phenyldiazenyl-propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 36719-42-3 | Molecular Weight | 233.35300 | |
| Density | 0.94g/cm3 | Boiling Point | 302.9ºC at 760 mmHg | |
| Molecular Formula | C14H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137ºC | |
| Name | 2-methyl-N-(2-methylpropyl)-N-phenyldiazenylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 302.9ºC at 760 mmHg |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.35300 |
| Flash Point | 137ºC |
| Exact Mass | 233.18900 |
| PSA | 27.96000 |
| LogP | 4.29930 |
| Index of Refraction | 1.511 |
| InChIKey | VELVAWLYPGJYKP-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)N=Nc1ccccc1 |
|
~%
2-methyl-N-(2-m... CAS#:36719-42-3 |
| Literature: Sieh,D.H.; Wilbur,D.J.; Michejda,C.J. Journal of the American Chemical Society, 1980 , vol. 102, p. 3883 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-phenyl-3,3-diisobutyltriazene |
| 3,3-diisobutyl-1-phenyl-triazene |
| 3,3-Diisobutyl-1-phenyl-triazen |