3-amino-2-phenylquinoline-4-carboxylic acid structure
|
Common Name | 3-amino-2-phenylquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 36735-26-9 | Molecular Weight | 264.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-amino-2-phenylquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12N2O2 |
|---|---|
| Molecular Weight | 264.27900 |
| Exact Mass | 264.09000 |
| PSA | 76.21000 |
| LogP | 3.76340 |
| InChIKey | WZYBQONKMQQIDY-UHFFFAOYSA-N |
| SMILES | Nc1c(-c2ccccc2)nc2ccccc2c1C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Amino-2-phenyl-chinolin-4-carbonsaeure |
| 3-amino-2-phenyl-quinoline-4-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: Molecular formula of 3-amino-2-phenylquinoline-4-carboxylic acid is C16H12N2O2. |
| Q: What are the downstream products of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: Related downstream products(CAS) of 3-amino-2-phenylquinoline-4-carboxylic acid: 485-89-2;5855-52-7. |
| Q: What is the SMILES notation of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: SMILES notation of 3-amino-2-phenylquinoline-4-carboxylic acid is Nc1c(-c2ccccc2)nc2ccccc2c1C(=O)O. |
| Q: What is the Chinese name of 36735-26-9? |
| A: Chinese name of 36735-26-9 is 36735-26-9. |
| Q: What English synonyms does 3-amino-2-phenylquinoline-4-carboxylic acid have? |
| A: English synonyms of 3-amino-2-phenylquinoline-4-carboxylic acid: 3-Amino-2-phenyl-chinolin-4-carbonsaeure, 3-amino-2-phenyl-quinoline-4-carboxylic acid. |
| Q: What is the CAS number of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: CAS number of 3-amino-2-phenylquinoline-4-carboxylic acid is 36735-26-9. |
| Q: What is the English name of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: The English name of 3-amino-2-phenylquinoline-4-carboxylic acid is 3-amino-2-phenylquinoline-4-carboxylic acid. |
| Q: What is the polar surface area (PSA) of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: Polar surface area (PSA) of 3-amino-2-phenylquinoline-4-carboxylic acid is 76.21000. |
| Q: What is the LogP of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: LogP of 3-amino-2-phenylquinoline-4-carboxylic acid is 3.76340. |
| Q: What is the molecular weight of 3-amino-2-phenylquinoline-4-carboxylic acid? |
| A: Molecular weight of 3-amino-2-phenylquinoline-4-carboxylic acid is 264.27900. |