2,2-dimethyl-4-phenyl-butyryl chloride
2,2-dimethyl-4-phenyl-butyryl chloride structure
|
Common Name | 2,2-dimethyl-4-phenyl-butyryl chloride | ||
|---|---|---|---|---|
| CAS Number | 36748-92-2 | Molecular Weight | 210.70000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-dimethyl-4-phenyl-butyryl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15ClO |
|---|---|
| Molecular Weight | 210.70000 |
| Exact Mass | 210.08100 |
| PSA | 17.07000 |
| LogP | 3.41080 |
| InChIKey | KGILTJFMPUKPSP-UHFFFAOYSA-N |
| SMILES | CC(C)(CCc1ccccc1)C(=O)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:13556-55-3
CAS#:2977-45-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2-Dimethyl-4-phenyl-buttersaeurechlorid |
| 2,2-Dimethyl-4-phenyl-butyrylchlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: LogP of 2,2-dimethyl-4-phenyl-butyryl chloride is 3.41080. |
| Q: What is the English name of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: The English name of 2,2-dimethyl-4-phenyl-butyryl chloride is 2,2-dimethyl-4-phenyl-butyryl chloride. |
| Q: What is the Chinese name of 36748-92-2? |
| A: Chinese name of 36748-92-2 is 36748-92-2. |
| Q: What is the polar surface area (PSA) of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: Polar surface area (PSA) of 2,2-dimethyl-4-phenyl-butyryl chloride is 17.07000. |
| Q: What is the CAS number of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: CAS number of 2,2-dimethyl-4-phenyl-butyryl chloride is 36748-92-2. |
| Q: What is the molecular formula of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: Molecular formula of 2,2-dimethyl-4-phenyl-butyryl chloride is C12H15ClO. |
| Q: What are the downstream products of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: Related downstream products(CAS) of 2,2-dimethyl-4-phenyl-butyryl chloride: 13556-55-3;2977-45-9. |
| Q: What is the molecular weight of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: Molecular weight of 2,2-dimethyl-4-phenyl-butyryl chloride is 210.70000. |
| Q: What English synonyms does 2,2-dimethyl-4-phenyl-butyryl chloride have? |
| A: English synonyms of 2,2-dimethyl-4-phenyl-butyryl chloride: 2,2-Dimethyl-4-phenyl-buttersaeurechlorid, 2,2-Dimethyl-4-phenyl-butyrylchlorid. |
| Q: What is the SMILES notation of 2,2-dimethyl-4-phenyl-butyryl chloride? |
| A: SMILES notation of 2,2-dimethyl-4-phenyl-butyryl chloride is CC(C)(CCc1ccccc1)C(=O)Cl. |