2-acetamido-4-bromophenyl acetate
2-acetamido-4-bromophenyl acetate structure
|
Common Name | 2-acetamido-4-bromophenyl acetate | ||
|---|---|---|---|---|
| CAS Number | 36749-01-6 | Molecular Weight | 272.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-acetamido-4-bromophenyl acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10BrNO3 |
|---|---|
| Molecular Weight | 272.09500 |
| Exact Mass | 270.98400 |
| PSA | 55.40000 |
| LogP | 2.40580 |
| InChIKey | XVIBHSRDCUPWFK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(Br)ccc1OC(C)=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:107986-49-2![6-Bromo-3,4-dihydro-2H-benzo[b][1,4]oxazine structure](https://image.chemsrc.com/caspic/317/105655-01-4.png)
CAS#:105655-01-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Acetamido-4-bromphenylacetat |
| 2-acetylamino-4-bromophenyl acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-acetamido-4-bromophenyl acetate? |
| A: LogP of 2-acetamido-4-bromophenyl acetate is 2.40580. |
| Q: What is the SMILES notation of 2-acetamido-4-bromophenyl acetate? |
| A: SMILES notation of 2-acetamido-4-bromophenyl acetate is CC(=O)Nc1cc(Br)ccc1OC(C)=O. |
| Q: What is the CAS number of 2-acetamido-4-bromophenyl acetate? |
| A: CAS number of 2-acetamido-4-bromophenyl acetate is 36749-01-6. |
| Q: What are the downstream products of 2-acetamido-4-bromophenyl acetate? |
| A: Related downstream products(CAS) of 2-acetamido-4-bromophenyl acetate: 107986-49-2;105655-01-4. |
| Q: What is the English name of 2-acetamido-4-bromophenyl acetate? |
| A: The English name of 2-acetamido-4-bromophenyl acetate is 2-acetamido-4-bromophenyl acetate. |
| Q: What is the InChIKey of 2-acetamido-4-bromophenyl acetate? |
| A: InChIKey of 2-acetamido-4-bromophenyl acetate is XVIBHSRDCUPWFK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-acetamido-4-bromophenyl acetate? |
| A: Molecular weight of 2-acetamido-4-bromophenyl acetate is 272.09500. |
| Q: What is the molecular formula of 2-acetamido-4-bromophenyl acetate? |
| A: Molecular formula of 2-acetamido-4-bromophenyl acetate is C10H10BrNO3. |
| Q: What is the Chinese name of 36749-01-6? |
| A: Chinese name of 36749-01-6 is 36749-01-6. |
| Q: What is the polar surface area (PSA) of 2-acetamido-4-bromophenyl acetate? |
| A: Polar surface area (PSA) of 2-acetamido-4-bromophenyl acetate is 55.40000. |