methyl 2-bromo-3,5-dinitro-benzoate structure
|
Common Name | methyl 2-bromo-3,5-dinitro-benzoate | ||
|---|---|---|---|---|
| CAS Number | 36749-41-4 | Molecular Weight | 305.03900 | |
| Density | 1.824g/cm3 | Boiling Point | 360.5ºC at 760 mmHg | |
| Molecular Formula | C8H5BrN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8ºC | |
| Name | methyl 2-bromo-3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.824g/cm3 |
|---|---|
| Boiling Point | 360.5ºC at 760 mmHg |
| Molecular Formula | C8H5BrN2O6 |
| Molecular Weight | 305.03900 |
| Flash Point | 171.8ºC |
| Exact Mass | 303.93300 |
| PSA | 117.94000 |
| LogP | 3.09850 |
| Index of Refraction | 1.621 |
| InChIKey | XSJXJYYYTKHXQW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Br |
| HS Code | 2916399090 |
|---|
|
~66%
methyl 2-bromo-... CAS#:36749-41-4 |
| Literature: PFIZER INC. Patent: WO2004/63198 A1, 2004 ; Location in patent: Page 79 ; WO 2004/063198 A1 |
|
~%
methyl 2-bromo-... CAS#:36749-41-4 |
| Literature: Adams; Snyder Journal of the American Chemical Society, 1938 , vol. 60, p. 1411,1413 |
|
~%
methyl 2-bromo-... CAS#:36749-41-4 |
| Literature: Adams; Snyder Journal of the American Chemical Society, 1938 , vol. 60, p. 1411,1413 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Brom-3,5-dinitro-benzoesaeure-methylester |
| 2-bromo-3,5-dinitro-benzoic acid methyl ester |