Pyridinium,2-bromo-1-(2-ethoxy-2-oxoethyl)-, bromide (1:1) structure
|
Common Name | Pyridinium,2-bromo-1-(2-ethoxy-2-oxoethyl)-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 36752-79-1 | Molecular Weight | 324.99700 | |
| Density | 1.426g/cm3 | Boiling Point | 299.2ºC at 760 mmHg | |
| Molecular Formula | C9H11Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | ethyl 2-(2-bromopyridin-1-ium-1-yl)acetate,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 299.2ºC at 760 mmHg |
| Molecular Formula | C9H11Br2NO2 |
| Molecular Weight | 324.99700 |
| Flash Point | 134.7ºC |
| Exact Mass | 322.91600 |
| PSA | 30.18000 |
| Index of Refraction | 1.538 |
| InChIKey | MVJJIUPIFOYBQD-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C[n+]1ccccc1Br.[Br-] |
|
~76%
Pyridinium,2-br... CAS#:36752-79-1 |
| Literature: Babaev; Smirnov; Rybakov Chemistry of Heterocyclic Compounds, 2005 , vol. 41, # 8 p. 1071 - 1075 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Brom-1-ethoxycarbonylmethylpyridiniumbromid |