3-METHYL-1-PHENYL-6,7-DIHYDRO-1H-INDAZOL-4(5H)-ONE structure
|
Common Name | 3-METHYL-1-PHENYL-6,7-DIHYDRO-1H-INDAZOL-4(5H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 36767-62-1 | Molecular Weight | 226.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1-phenyl-6,7-dihydro-5H-indazol-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O |
|---|---|
| Molecular Weight | 226.27400 |
| Exact Mass | 226.11100 |
| PSA | 34.89000 |
| LogP | 2.69970 |
| InChIKey | HDRDLRJTFBFSNX-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(=O)CCC2 |
| HS Code | 2933990090 |
|---|
|
~%
3-METHYL-1-PHEN... CAS#:36767-62-1 |
| Literature: Smith Journal of the Chemical Society, 1953 , p. 803,808 |
|
~%
3-METHYL-1-PHEN... CAS#:36767-62-1 |
| Literature: Smith Journal of the Chemical Society, 1953 , p. 803,808 |
|
~%
3-METHYL-1-PHEN... CAS#:36767-62-1 |
| Literature: Smith Journal of the Chemical Society, 1953 , p. 803,808 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-methyl-1-phenyl-6,7-dihydro-1H-indazol-4(5H)-one |
| 3-methyl-1-phenyl-1,5,6,7-tetrahydro-indazol-4-one |
| 1-phenyl-3-methyl-4-oxo-4,5,6,7-tetrahydroindazole |
| 3-Methyl-4-oxo-1-phenyl-4,5,6,7-tetrahydroindazol |
| 3-Methyl-1-phenyl-1,5,6,7-tetrahydro-indazol-4-on |
| 3-methyl-1-phenyl-1,5,6,7-tetrahydro-4H-indazol-4-one |