1,2,3,4-Tetrahydro-4,6-dihydroxy-2-methyl-1-isoquinolinecarboxylic acid 2-methylpropyl ester structure
|
Common Name | 1,2,3,4-Tetrahydro-4,6-dihydroxy-2-methyl-1-isoquinolinecarboxylic acid 2-methylpropyl ester | ||
|---|---|---|---|---|
| CAS Number | 36769-48-9 | Molecular Weight | 279.33200 | |
| Density | 1.213g/cm3 | Boiling Point | 427.4ºC at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.3ºC | |
| Name | 2-methylpropyl 4,6-dihydroxy-2-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 427.4ºC at 760 mmHg |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.33200 |
| Flash Point | 212.3ºC |
| Exact Mass | 279.14700 |
| PSA | 70.00000 |
| LogP | 1.54920 |
| Index of Refraction | 1.564 |
| InChIKey | LRSDNUVUJLHRAP-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1c2ccc(O)cc2C(O)CN1C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |