7,8-dimethoxy-2,2-dimethyl-chroman-4-one
7,8-dimethoxy-2,2-dimethyl-chroman-4-one structure
|
Common Name | 7,8-dimethoxy-2,2-dimethyl-chroman-4-one | ||
|---|---|---|---|---|
| CAS Number | 36772-91-5 | Molecular Weight | 236.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,8-dimethoxy-2,2-dimethyl-chroman-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O4 |
|---|---|
| Molecular Weight | 236.26400 |
| Exact Mass | 236.10500 |
| PSA | 44.76000 |
| LogP | 2.44760 |
| InChIKey | BLMSHROQMPROQW-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)OC(C)(C)CC2=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:67015-35-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7,8-Dimethoxy-2,2-dimethylchroman-4-on |
| 7,8-dimethoxy-2,2-dimethyl-4-chromanone |
| 7,8-Dimethoxy-2,2-dimethyl-chroman-4-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 36772-91-5? |
| A: Chinese name of 36772-91-5 is 36772-91-5. |
| Q: What is the English name of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: The English name of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one is 7,8-dimethoxy-2,2-dimethyl-chroman-4-one. |
| Q: What are the downstream products of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: Related downstream products(CAS) of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one: 67015-35-4. |
| Q: What is the CAS number of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: CAS number of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one is 36772-91-5. |
| Q: What is the SMILES notation of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: SMILES notation of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one is COc1ccc2c(c1OC)OC(C)(C)CC2=O. |
| Q: What is the LogP of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: LogP of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one is 2.44760. |
| Q: What is the InChIKey of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: InChIKey of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one is BLMSHROQMPROQW-UHFFFAOYSA-N. |
| Q: What English synonyms does 7,8-dimethoxy-2,2-dimethyl-chroman-4-one have? |
| A: English synonyms of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one: 7,8-Dimethoxy-2,2-dimethylchroman-4-on, 7,8-dimethoxy-2,2-dimethyl-4-chromanone, 7,8-Dimethoxy-2,2-dimethyl-chroman-4-on. |
| Q: What is the molecular formula of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: Molecular formula of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one is C13H16O4. |
| Q: What is the polar surface area (PSA) of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one? |
| A: Polar surface area (PSA) of 7,8-dimethoxy-2,2-dimethyl-chroman-4-one is 44.76000. |