Phosphinothioic acid, bis(1-aziridinyl)-, O-phenyl ester
Modify Date: 2025-10-23 18:57:12
Phosphinothioic acid, bis(1-aziridinyl)-, O-phenyl ester structure
|
Common Name | Phosphinothioic acid, bis(1-aziridinyl)-, O-phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 3678-01-1 | Molecular Weight | 240.26200 | |
| Density | 1.39g/cm3 | Boiling Point | 329ºC at 760 mmHg | |
| Molecular Formula | C10H13N2OPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.8ºC | |
| Name | Phosphinothioic acid, bis(1-aziridinyl)-, O-phenyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 329ºC at 760 mmHg |
| Molecular Formula | C10H13N2OPS |
| Molecular Weight | 240.26200 |
| Flash Point | 152.8ºC |
| Exact Mass | 240.04900 |
| PSA | 57.15000 |
| LogP | 2.44750 |
| Index of Refraction | 1.673 |
| InChIKey | DVZFWRRAIDTGNH-UHFFFAOYSA-N |
| SMILES | S=P(Oc1ccccc1)(N1CC1)N1CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bis-aziridin-1-yl-phosphinothioic acid O-phenyl ester |
| O-Phenyl-N.N'-diaethylen-phosphordiamidothionat |
| diaziridin-1-yl-phenoxy-sulfanylidene-phosphorane |