3-(N-ethyl-3-methylanilino)propane-1-sulfonic acid structure
|
Common Name | 3-(N-ethyl-3-methylanilino)propane-1-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 36783-03-6 | Molecular Weight | 257.34900 | |
| Density | 1.215g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(N-ethyl-3-methylanilino)propane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.34900 |
| Exact Mass | 257.10900 |
| PSA | 65.99000 |
| LogP | 3.18000 |
| Index of Refraction | 1.562 |
| InChIKey | IBSUMVZKDLDAEK-UHFFFAOYSA-N |
| SMILES | CCN(CCCS(=O)(=O)O)c1cccc(C)c1 |
| HS Code | 2921499090 |
|---|
|
~%
3-(N-ethyl-3-me... CAS#:36783-03-6 |
| Literature: Tong,L.K.J. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 1988 - 1996 |
|
~%
3-(N-ethyl-3-me... CAS#:36783-03-6 |
| Literature: Tong,L.K.J. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 1988 - 1996 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-Aethyl-3-methyl-N-<3-sulfopropyl>-anilin |
| EINECS 253-210-1 |
| 3-[ethyl(3-methylphenyl)amino]propane-1-sulfonic acid |
| 3-[ethyl(3-methylphenyl)amino]propanesulfonic acid |
| 3-(Ethyl(3-methylphenyl)amino)propanesulphonic acid |