3,3-dimethyl-1-(methyl-phenyl-amino)butan-2-one
3,3-dimethyl-1-(methyl-phenyl-amino)butan-2-one structure
|
Common Name | 3,3-dimethyl-1-(methyl-phenyl-amino)butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 36810-75-0 | Molecular Weight | 205.29600 | |
| Density | 0.991g/cm3 | Boiling Point | 294.5ºC at 760 mmHg | |
| Molecular Formula | C13H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3-dimethyl-1-(N-methylanilino)butan-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.991g/cm3 |
|---|---|
| Boiling Point | 294.5ºC at 760 mmHg |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.29600 |
| Flash Point | 97ºC |
| Exact Mass | 205.14700 |
| PSA | 20.31000 |
| LogP | 2.73800 |
| Index of Refraction | 1.527 |
| InChIKey | MCOWYXNHOPZOTK-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)C(C)(C)C)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~10%
3,3-dimethyl-1-... CAS#:36810-75-0 |
| Literature: Tayama, Eiji; Ishikawa, Moe; Iwamoto, Hajime; Hasegawa, Eietsu Tetrahedron Letters, 2012 , vol. 53, # 38 p. 5159 - 5161 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 36810-75-0? |
| A: Chinese name of 36810-75-0 is 36810-75-0. |
| Q: What is the InChIKey of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: InChIKey of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is MCOWYXNHOPZOTK-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: Polar surface area (PSA) of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is 20.31000. |
| Q: What is the molecular weight of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: Molecular weight of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is 205.29600. |
| Q: What is the SMILES notation of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: SMILES notation of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is CN(CC(=O)C(C)(C)C)c1ccccc1. |
| Q: What are the upstream materials of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: Related upstream materials(CAS) of 3,3-dimethyl-1-(N-methylanilino)butan-2-one: 5469-26-1;100-61-8. |
| Q: What is the boiling point of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: Boiling point of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is 294.5ºC at 760 mmHg. |
| Q: What is the CAS number of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: CAS number of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is 36810-75-0. |
| Q: What is the English name of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: The English name of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is 3,3-dimethyl-1-(N-methylanilino)butan-2-one. |
| Q: What is the molecular formula of 3,3-dimethyl-1-(N-methylanilino)butan-2-one? |
| A: Molecular formula of 3,3-dimethyl-1-(N-methylanilino)butan-2-one is C13H19NO. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |