1-(2-ethoxyphenyl)pyrrole-2,5-dione structure
|
Common Name | 1-(2-ethoxyphenyl)pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 36817-57-9 | Molecular Weight | 217.22100 | |
| Density | 1.272g/cm3 | Boiling Point | 354.4ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1ºC | |
| Name | 1-(2-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 354.4ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 168.1ºC |
| Exact Mass | 217.07400 |
| PSA | 46.61000 |
| LogP | 1.57970 |
| Index of Refraction | 1.59 |
| InChIKey | RRXDDBJMCPRNNO-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1N1C(=O)C=CC1=O |
| HS Code | 2925190090 |
|---|
|
~70%
1-(2-ethoxyphen... CAS#:36817-57-9 |
| Literature: Solow-Cordero, David; Shankar, Geetha; Spencer, Juliet; Gluchowski, Charles Patent: US2005/101518 A1, 2005 ; Location in patent: Page/Page column 22-23 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ethoxyphenylmaleimide |
| ethyl ethoxy(phenyl)acetate |
| N-o-Ethoxyphenylmaleamid |
| N-(2-ethoxyphenyl)maleimide |
| ethoxyphenylacetic acid ethyl ester |
| Aethoxy-phenyl-essigsaeure-aethylester |