Isohemiphloin structure
|
Common Name | Isohemiphloin | ||
|---|---|---|---|---|
| CAS Number | 3682-02-8 | Molecular Weight | 434.393 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 785.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.5±26.4 °C | |
Use of IsohemiphloinIsohemiphloin is a flavonoid compound[1]. |
| Name | (1S)-1,5-Anhydro-1-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo- 3,4-dihydro-2H-chromen-8-yl]-D-glucitol |
|---|---|
| Synonym | More Synonyms |
| Description | Isohemiphloin is a flavonoid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 785.2±60.0 °C at 760 mmHg |
| Molecular Formula | C21H22O10 |
| Molecular Weight | 434.393 |
| Flash Point | 278.5±26.4 °C |
| Exact Mass | 434.121307 |
| PSA | 177.14000 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | VPQWOQSQAVBHEV-MORHTPAJSA-N |
| SMILES | O=C1CC(c2ccc(O)cc2)Oc2c1c(O)cc(O)c2C1OC(CO)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| (1R)-1,5-Anhydro-1-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-8-yl]-D-glucitol |
| (1S)-1,5-Anhydro-1-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-chromen-8-yl]-D-glucitol |