Hydrazinecarbothioamide,2-[1-(4-bromo-3-methyl-5-isothiazolyl)ethylidene]-N-methyl structure
|
Common Name | Hydrazinecarbothioamide,2-[1-(4-bromo-3-methyl-5-isothiazolyl)ethylidene]-N-methyl | ||
|---|---|---|---|---|
| CAS Number | 3683-53-2 | Molecular Weight | 307.23400 | |
| Density | 1.66g/cm3 | Boiling Point | 312.6ºC at 760mmHg | |
| Molecular Formula | C8H11BrN4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.9ºC | |
| Name | 1-[(E)-1-(4-bromo-3-methyl-1,2-thiazol-5-yl)ethylideneamino]-3-methylthiourea |
|---|
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 312.6ºC at 760mmHg |
| Molecular Formula | C8H11BrN4S2 |
| Molecular Weight | 307.23400 |
| Flash Point | 142.9ºC |
| Exact Mass | 305.96100 |
| PSA | 109.64000 |
| LogP | 2.81370 |
| Index of Refraction | 1.696 |
| InChIKey | GKVVEJDSSBODQG-WZUFQYTHSA-N |
| SMILES | CNC(=S)NN=C(C)c1snc(C)c1Br |
|
~%
Hydrazinecarbot... CAS#:3683-53-2 |
| Literature: Caton,M.P.L. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 680 - 683 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |