N-[α-(p-Ethoxyphenyl)phenethyl]-1-piperidineacetamide
Modify Date: 2025-08-26 12:21:21
![N-[α-(p-Ethoxyphenyl)phenethyl]-1-piperidineacetamide Structure](https://image.chemsrc.com/caspic/175/36838-40-1.png)
N-[α-(p-Ethoxyphenyl)phenethyl]-1-piperidineacetamide structure
|
Common Name | N-[α-(p-Ethoxyphenyl)phenethyl]-1-piperidineacetamide | ||
|---|---|---|---|---|
| CAS Number | 36838-40-1 | Molecular Weight | 366.49700 | |
| Density | 1.088g/cm3 | Boiling Point | 550.8ºC at 760 mmHg | |
| Molecular Formula | C23H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.9ºC | |
| Name | N-[1-(4-ethoxyphenyl)-2-phenylethyl]-2-piperidin-1-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 550.8ºC at 760 mmHg |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.49700 |
| Flash Point | 286.9ºC |
| Exact Mass | 366.23100 |
| PSA | 45.06000 |
| LogP | 4.74940 |
| Index of Refraction | 1.561 |
| InChIKey | SQZYSZBLKALDPA-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(Cc2ccccc2)NC(=O)CN2CCCCC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| n-[1-(4-ethoxyphenyl)-2-phenylethyl]-2-(piperidin-1-yl)acetamide |