2-methoxymethoxy-4-(trifluoromethyl)benzene
2-methoxymethoxy-4-(trifluoromethyl)benzene structure
|
Common Name | 2-methoxymethoxy-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 368422-29-1 | Molecular Weight | 250.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Methoxymethoxy-4-(trifluoromethyl)benzene, CAS 368422-29-1, molecular formula C10H9F3O4, molecular weight 250.17100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methoxymethoxy-4-(trifluoromethyl)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9F3O4 |
|---|---|
| Molecular Weight | 250.17100 |
| Exact Mass | 250.04500 |
| PSA | 55.76000 |
| LogP | 2.38630 |
| InChIKey | NLCWXYCTNTYKGZ-UHFFFAOYSA-N |
| SMILES | COCOc1cc(C(F)(F)F)ccc1C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:328-90-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: LogP of 2-methoxymethoxy-4-(trifluoromethyl)benzene is 2.38630. |
| Q: What is the molecular formula of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: Molecular formula of 2-methoxymethoxy-4-(trifluoromethyl)benzene is C10H9F3O4. |
| Q: What is the SMILES notation of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: SMILES notation of 2-methoxymethoxy-4-(trifluoromethyl)benzene is COCOc1cc(C(F)(F)F)ccc1C(=O)O. |
| Q: What is the InChIKey of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: InChIKey of 2-methoxymethoxy-4-(trifluoromethyl)benzene is NLCWXYCTNTYKGZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: Polar surface area (PSA) of 2-methoxymethoxy-4-(trifluoromethyl)benzene is 55.76000. |
| Q: What is the CAS number of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: CAS number of 2-methoxymethoxy-4-(trifluoromethyl)benzene is 368422-29-1. |
| Q: What is the Chinese name of 368422-29-1? |
| A: Chinese name of 368422-29-1 is 368422-29-1. |
| Q: What are the downstream products of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: Related downstream products(CAS) of 2-methoxymethoxy-4-(trifluoromethyl)benzene: 328-90-5. |
| Q: What is the molecular weight of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: Molecular weight of 2-methoxymethoxy-4-(trifluoromethyl)benzene is 250.17100. |
| Q: What is the English name of 2-methoxymethoxy-4-(trifluoromethyl)benzene? |
| A: The English name of 2-methoxymethoxy-4-(trifluoromethyl)benzene is 2-methoxymethoxy-4-(trifluoromethyl)benzene. |