1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate
Modify Date: 2026-08-08 17:02:17
![1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate Structure](https://www.chemsrc.com/extcaspic/414/368443-50-9.png)
1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate structure
|
Common Name | 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate | ||
|---|---|---|---|---|
| CAS Number | 368443-50-9 | Molecular Weight | 287.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21NO6 |
|---|---|
| Molecular Weight | 287.31 |
| InChIKey | KYKNNIMLGUGDHF-SECBINFHSA-N |
| SMILES | C=CCOC(=O)CC(NC(=O)OC(C)(C)C)C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate? |
| A: SMILES notation of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate is C=CCOC(=O)CC(NC(=O)OC(C)(C)C)C(=O)OC. |
| Q: What is the molecular weight of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate? |
| A: Molecular weight of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate is 287.31. |
| Q: What is the molecular formula of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate? |
| A: Molecular formula of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate is C13H21NO6. |
| Q: What is the InChIKey of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate? |
| A: InChIKey of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate is KYKNNIMLGUGDHF-SECBINFHSA-N. |
| Q: What is the English name of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate? |
| A: The English name of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate is 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate. |
| Q: What is the CAS number of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate? |
| A: CAS number of 1-methyl 4-prop-2-en-1-yl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate is 368443-50-9. |
| Q: What is the Chinese name of 368443-50-9? |
| A: Chinese name of 368443-50-9 is 368443-50-9. |