galactinol dihydrate structure
|
Common Name | galactinol dihydrate | ||
|---|---|---|---|---|
| CAS Number | 3687-64-7 | Molecular Weight | 342.29600 | |
| Density | 1.84g/cm3 | Boiling Point | 609.9ºC at 760mmHg | |
| Molecular Formula | C12H22O11 | Melting Point | 114ºC | |
| MSDS | N/A | Flash Point | 322.7ºC | |
Use of galactinol dihydrateGalactinol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | α-D-galactosyl-(1→3)-1D-myo-inositol |
|---|---|
| Synonym | More Synonyms |
| Description | Galactinol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.84g/cm3 |
|---|---|
| Boiling Point | 609.9ºC at 760mmHg |
| Melting Point | 114ºC |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.29600 |
| Flash Point | 322.7ºC |
| Exact Mass | 342.11600 |
| PSA | 200.53000 |
| Index of Refraction | 1.686 |
| InChIKey | HGCURVXTXVAIIR-FMQVHOFPSA-N |
| SMILES | O.O.OCC1OC(OC2C(O)C(O)C(O)C(O)C2O)C(O)C(O)C1O |
| HS Code | 29389090 |
|---|
| EINECS 222-982-1 |
| GALACTINOL DIHYDRATE |
| 1-O-α-D-Galactopyranosyl-L-myo-inositol Hydrate |
| alpha-D-galactosyl-(1->3)-1D-myo-inositol |
| Galactinol hydrate |