2-[2-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)ethyl]cyclopentan-1-one structure
|
Common Name | 2-[2-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)ethyl]cyclopentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 36871-43-9 | Molecular Weight | 237.33800 | |
| Density | 1.11g/cm3 | Boiling Point | 331.5ºC at 760 mmHg | |
| Molecular Formula | C14H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.2ºC | |
| Name | 2-[2-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)ethyl]cyclopentan-1-one |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 331.5ºC at 760 mmHg |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.33800 |
| Flash Point | 129.2ºC |
| Exact Mass | 237.17300 |
| PSA | 38.66000 |
| LogP | 2.55730 |
| Index of Refraction | 1.546 |
| InChIKey | JDQNJTCLFUOCRX-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(C)N=C(CCC2CCCC2=O)O1 |
|
~%
2-[2-(4,4,6-tri... CAS#:36871-43-9 |
| Literature: Meyers,A.I. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 36 - 56 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |