2-(5-bromopentyl)-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine structure
|
Common Name | 2-(5-bromopentyl)-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine | ||
|---|---|---|---|---|
| CAS Number | 36871-48-4 | Molecular Weight | 276.21300 | |
| Density | 1.23g/cm3 | Boiling Point | 305.9ºC at 760 mmHg | |
| Molecular Formula | C12H22BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.8ºC | |
| Name | 2-(5-bromopentyl)-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 305.9ºC at 760 mmHg |
| Molecular Formula | C12H22BrNO |
| Molecular Weight | 276.21300 |
| Flash Point | 138.8ºC |
| Exact Mass | 275.08800 |
| PSA | 21.59000 |
| LogP | 3.36320 |
| Index of Refraction | 1.513 |
| InChIKey | CNEDXHUUQWJBBJ-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(C)N=C(CCCCCBr)O1 |
|
~%
2-(5-bromopenty... CAS#:36871-48-4 |
| Literature: Meyers,A.I. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 36 - 56 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(5-bromo-pentyl)-4,4,6-trimethyl-5,6-dihydro-4H-[1,3]oxazine |