4H-1,3-Oxazine,2-(5-chloropentyl)-5,6-dihydro-4,4,6-trimethyl- structure
|
Common Name | 4H-1,3-Oxazine,2-(5-chloropentyl)-5,6-dihydro-4,4,6-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 36871-49-5 | Molecular Weight | 231.76200 | |
| Density | 1.05g/cm3 | Boiling Point | 291.2ºC at 760mmHg | |
| Molecular Formula | C12H22ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | 2-(5-chloropentyl)-4,4,6-trimethyl-5,6-dihydro-1,3-oxazine |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 291.2ºC at 760mmHg |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.76200 |
| Flash Point | 129.9ºC |
| Exact Mass | 231.13900 |
| PSA | 21.59000 |
| LogP | 3.20710 |
| Index of Refraction | 1.495 |
| InChIKey | GSDPYAMUHIXDIT-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(C)N=C(CCCCCCl)O1 |
|
~%
4H-1,3-Oxazine,... CAS#:36871-49-5 |
| Literature: Meyers,A.I. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 36 - 56 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |