3',6'-DIMETHOXYFLUORAN structure
|
Common Name | 3',6'-DIMETHOXYFLUORAN | ||
|---|---|---|---|---|
| CAS Number | 36886-76-7 | Molecular Weight | 360.359 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 559.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H16O5 | Melting Point | 202ºC | |
| MSDS | N/A | Flash Point | 247.2±30.2 °C | |
| Name | 3',6'-dimethoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.9±50.0 °C at 760 mmHg |
| Melting Point | 202ºC |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.359 |
| Flash Point | 247.2±30.2 °C |
| Exact Mass | 360.099762 |
| PSA | 53.99000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | GRIKUIPJBHJPPN-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)Oc1cc(OC)ccc1C21OC(=O)c2ccccc21 |
| HS Code | 2932999099 |
|---|
|
~65%
3',6'-DIMETHOXY... CAS#:36886-76-7 |
| Literature: Rao, Honghua; Wang, Ping; Li, Chao-Jun European Journal of Organic Chemistry, 2012 , # 33 p. 6503 - 6507 |
|
~%
3',6'-DIMETHOXY... CAS#:36886-76-7 |
| Literature: v. Liebig Journal fuer Praktische Chemie (Leipzig), 1912 , vol. <2> 85, p. 255 Chemische Berichte, 1914 , vol. 47, p. 2597 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Yellow Y 1 |
| Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one, 3',6'-dimethoxy- |
| Dimethyl-fluorescein |
| 3',6'-Dimethoxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dimethoxy- |
| 3',6'-DiMethoxyfluoran |
| 3',6'-Dimethoxyspiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-one |
| 3,6-dimethoxyfluoran |
| EINECS 253-255-7 |