2-methyl-7-nitro-3,1-benzoxazin-4-one
Modify Date: 2025-09-11 08:28:56
2-methyl-7-nitro-3,1-benzoxazin-4-one structure
|
Common Name | 2-methyl-7-nitro-3,1-benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 3689-31-4 | Molecular Weight | 206.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-7-nitro-3,1-benzoxazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6N2O4 |
|---|---|
| Molecular Weight | 206.15500 |
| Exact Mass | 206.03300 |
| PSA | 88.92000 |
| LogP | 1.92780 |
| InChIKey | BJWQRWNSQNZFLS-UHFFFAOYSA-N |
| SMILES | Cc1nc2cc([N+](=O)[O-])ccc2c(=O)o1 |
| HS Code | 2934999090 |
|---|
|
~%
2-methyl-7-nitr... CAS#:3689-31-4 |
| Literature: Bogert; Steiner Journal of the American Chemical Society, 1905 , vol. 27, p. 1330 |
|
~81%
2-methyl-7-nitr... CAS#:3689-31-4 |
| Literature: Zhao, Haibo; Fu, Hua; Qiao, Renzhong Journal of Organic Chemistry, 2010 , vol. 75, # 10 p. 3311 - 3316 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methyl-7-nitro-4H-3,1-benzoxazin-4-one |
| 7-Nitro-2-methyl-4-oxo-4H-3,1-benzoxazin |
| 4H-3,1-Benzoxazin-4-one,2-methyl-7-nitro |
| 2-Methyl-7-nitro-benz[d][1,3]oxazin-4-on |
| 2-methyl-7-nitro-benzo[d][1,3]oxazin-4-one |
| 2-methyl-7-nitro-3,1-benzoxazin-4(H)-one |
| 2-methyl-7-nitro-benz[d][1,3]oxazin-4-one |
| 7-Nitro-2-methyl-benzoxazon (4-Nitro-acet-anthranil) |