Benzenepropanoic acid,2-chloro-6-nitro-a-oxo- structure
|
Common Name | Benzenepropanoic acid,2-chloro-6-nitro-a-oxo- | ||
|---|---|---|---|---|
| CAS Number | 36892-19-0 | Molecular Weight | 243.60100 | |
| Density | 1.578g/cm3 | Boiling Point | 394.9ºC at 760 mmHg | |
| Molecular Formula | C9H6ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6ºC | |
| Name | 3-(2-chloro-6-nitrophenyl)-2-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.578g/cm3 |
|---|---|
| Boiling Point | 394.9ºC at 760 mmHg |
| Molecular Formula | C9H6ClNO5 |
| Molecular Weight | 243.60100 |
| Flash Point | 192.6ºC |
| Exact Mass | 242.99300 |
| PSA | 100.19000 |
| LogP | 1.96760 |
| Index of Refraction | 1.609 |
| InChIKey | ZHHGJIKNTVWZTL-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)Cc1c(Cl)cccc1[N+](=O)[O-] |
| HS Code | 2918300090 |
|---|
|
~%
Benzenepropanoi... CAS#:36892-19-0 |
| Literature: Fagan, Gay P.; Chapleo, Christopher B.; Lane, Anthony C.; Myers, Malcolm; Roach, Alan G.; et al Journal of Medicinal Chemistry, 1988 , vol. 31, # 5 p. 944 - 948 |
|
~%
Benzenepropanoi... CAS#:36892-19-0 |
| Literature: Uhle Journal of the American Chemical Society, 1949 , vol. 71, p. 761,763 |
|
~%
Benzenepropanoi... CAS#:36892-19-0 |
| Literature: Acheson,R.M.; Vernon,J.M. Journal of the Chemical Society, 1962 , p. 1148 - 1157 |
|
~%
Benzenepropanoi... CAS#:36892-19-0 |
| Literature: Uhle Journal of the American Chemical Society, 1949 , vol. 71, p. 761,763 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (2-chloro-6-nitro-phenyl)-pyruvic acid |
| 2-Oxo-3-(6-chlor-2-nitro-phenyl)-propionsaeure |
| 3-<6-Chlor-2-nitro-phenyl>-brenztraubensaeure |
| (2-Chlor-6-nitro-phenyl)-brenztraubensaeure |