Benzenediazonium hexafluorophosphate
Benzenediazonium hexafluorophosphate structure
|
Common Name | Benzenediazonium hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 369-58-4 | Molecular Weight | 250.08100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5F6N2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenediazonium hexafluorophosphate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5F6N2P |
|---|---|
| Molecular Weight | 250.08100 |
| Exact Mass | 250.00900 |
| PSA | 41.74000 |
| LogP | 5.55358 |
| InChIKey | GIDPFONPWSEBOB-UHFFFAOYSA-N |
| SMILES | F[P-](F)(F)(F)(F)F.N#[N+]c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:98-95-3
CAS#:86-00-0
CAS#:2113-58-8
CAS#:92-93-3
CAS#:92-52-4
CAS#:108-90-7
CAS#:103-84-4
CAS#:71-43-2
CAS#:100-63-0
CAS#:101-05-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzenediazonium hexafluorophosphate? |
| A: InChIKey of Benzenediazonium hexafluorophosphate is GIDPFONPWSEBOB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benzenediazonium hexafluorophosphate? |
| A: SMILES notation of Benzenediazonium hexafluorophosphate is F[P-](F)(F)(F)(F)F.N#[N+]c1ccccc1. |
| Q: What is the molecular formula of Benzenediazonium hexafluorophosphate? |
| A: Molecular formula of Benzenediazonium hexafluorophosphate is C6H5F6N2P. |
| Q: What is the LogP of Benzenediazonium hexafluorophosphate? |
| A: LogP of Benzenediazonium hexafluorophosphate is 5.55358. |
| Q: What is the molecular weight of Benzenediazonium hexafluorophosphate? |
| A: Molecular weight of Benzenediazonium hexafluorophosphate is 250.08100. |
| Q: What is the English name of Benzenediazonium hexafluorophosphate? |
| A: The English name of Benzenediazonium hexafluorophosphate is Benzenediazonium hexafluorophosphate. |
| Q: What is the Chinese name of 369-58-4? |
| A: Chinese name of 369-58-4 is 369-58-4. |
| Q: What is the CAS number of Benzenediazonium hexafluorophosphate? |
| A: CAS number of Benzenediazonium hexafluorophosphate is 369-58-4. |
| Q: What are the downstream products of Benzenediazonium hexafluorophosphate? |
| A: Related downstream products(CAS) of Benzenediazonium hexafluorophosphate: 98-95-3;86-00-0;2113-58-8;92-93-3;92-52-4;108-90-7;103-84-4;71-43-2;100-63-0;101-05-3. |
| Q: What is the polar surface area (PSA) of Benzenediazonium hexafluorophosphate? |
| A: Polar surface area (PSA) of Benzenediazonium hexafluorophosphate is 41.74000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |