3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol
Modify Date: 2026-07-27 16:52:00
3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol structure
|
Common Name | 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol | ||
|---|---|---|---|---|
| CAS Number | 369-69-7 | Molecular Weight | 240.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8ClF3O2 |
|---|---|
| Molecular Weight | 240.60 |
| InChIKey | HAHKWHRSGUOECQ-UHFFFAOYSA-N |
| SMILES | OCc1cccc(OC(F)(F)C(F)Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol? |
| A: Molecular formula of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol is C9H8ClF3O2. |
| Q: What is the English name of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol? |
| A: The English name of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol is 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol. |
| Q: What is the Chinese name of 369-69-7? |
| A: Chinese name of 369-69-7 is 369-69-7. |
| Q: What is the InChIKey of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol? |
| A: InChIKey of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol is HAHKWHRSGUOECQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol? |
| A: SMILES notation of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol is OCc1cccc(OC(F)(F)C(F)Cl)c1. |
| Q: What is the CAS number of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol? |
| A: CAS number of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol is 369-69-7. |
| Q: What is the molecular weight of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol? |
| A: Molecular weight of 3-(2-Chloro-1,1,2-trifluoroethoxy)benzenemethanol is 240.60. |