1,3-bis(3-fluorophenyl)urea
1,3-bis(3-fluorophenyl)urea structure
|
Common Name | 1,3-bis(3-fluorophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 369-83-5 | Molecular Weight | 248.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10F2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-bis(3-fluorophenyl)urea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10F2N2O |
|---|---|
| Molecular Weight | 248.22800 |
| Exact Mass | 248.07600 |
| PSA | 41.13000 |
| LogP | 3.75480 |
| InChIKey | BYAWSEIGDSOCFJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(F)c1)Nc1cccc(F)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1,3-bis(3-fluorophenyl)urea? |
| A: LogP of 1,3-bis(3-fluorophenyl)urea is 3.75480. |
| Q: What is the molecular weight of 1,3-bis(3-fluorophenyl)urea? |
| A: Molecular weight of 1,3-bis(3-fluorophenyl)urea is 248.22800. |
| Q: What is the molecular formula of 1,3-bis(3-fluorophenyl)urea? |
| A: Molecular formula of 1,3-bis(3-fluorophenyl)urea is C13H10F2N2O. |
| Q: What is the InChIKey of 1,3-bis(3-fluorophenyl)urea? |
| A: InChIKey of 1,3-bis(3-fluorophenyl)urea is BYAWSEIGDSOCFJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3-bis(3-fluorophenyl)urea? |
| A: CAS number of 1,3-bis(3-fluorophenyl)urea is 369-83-5. |
| Q: What is the SMILES notation of 1,3-bis(3-fluorophenyl)urea? |
| A: SMILES notation of 1,3-bis(3-fluorophenyl)urea is O=C(Nc1cccc(F)c1)Nc1cccc(F)c1. |
| Q: What is the English name of 1,3-bis(3-fluorophenyl)urea? |
| A: The English name of 1,3-bis(3-fluorophenyl)urea is 1,3-bis(3-fluorophenyl)urea. |
| Q: What is the polar surface area (PSA) of 1,3-bis(3-fluorophenyl)urea? |
| A: Polar surface area (PSA) of 1,3-bis(3-fluorophenyl)urea is 41.13000. |
| Q: What is the Chinese name of 369-83-5? |
| A: Chinese name of 369-83-5 is 369-83-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |