N-(4-Nitrophenyl)-3-(trifluoromethyl)aniline structure
|
Common Name | N-(4-Nitrophenyl)-3-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 369-90-4 | Molecular Weight | 282.21800 | |
| Density | 1.405g/cm3 | Boiling Point | 370.5ºC at 760 mmHg | |
| Molecular Formula | C13H9F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.9ºC | |
| Name | N-(4-Nitrophenyl)-3-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 370.5ºC at 760 mmHg |
| Molecular Formula | C13H9F3N2O2 |
| Molecular Weight | 282.21800 |
| Flash Point | 177.9ºC |
| Exact Mass | 282.06200 |
| PSA | 57.85000 |
| LogP | 4.95340 |
| Index of Refraction | 1.583 |
| InChIKey | UDHNPQBBLGONPJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2cccc(C(F)(F)F)c2)cc1 |
|
~72%
N-(4-Nitropheny... CAS#:369-90-4 |
| Literature: Takeuchi, Tomoki; Oishi, Shinya; Kaneda, Masato; Misu, Ryosuke; Ohno, Hiroaki; Sawada, Jun-Ichi; Asai, Akira; Nakamura, Shinya; Nakanishi, Isao; Fujii, Nobutaka Bioorganic and Medicinal Chemistry, 2014 , vol. 22, # 12 p. 3171 - 3179 |
|
~%
N-(4-Nitropheny... CAS#:369-90-4 |
| Literature: Viswanathan, N.; Desai, Ranjit C. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 4 p. 308 - 310 |
|
~%
N-(4-Nitropheny... CAS#:369-90-4 |
| Literature: Tschernezkii et al. Zhurnal Obshchei Khimii, 1955 , vol. 25, p. 2161,2167; engl. Ausg. S. 2123, 2128 |
| 4-Nitro-3'-trifluoromethyldiphenylamin |
| 2-NITRO-5-BROMOBENZOTRIFLUORID |
| 4-bromo-1-nitro-2-(trifluoromethyl)benzene |
| 2-nitro-5-broMotrifluorotoluol |
| 5-Bromo-2-nitro |
| 5-BroMo-2-nitro-trifluoroMethyl |
| (4-nitro-phenyl)-(3-trifluoromethyl-phenyl)-amine |
| 3-(trifluoromethyl)-4-nitrobromobenzene |
| 4-Nitro-3'-trifluormethyl-diphenylamin |
| 1-bromo-4-nitro-3-trifluoromethylbenzene |
| 5-nitro-2-nitrobenzotrifluoride |
| 4-Nitro-3'-trifluoromethyldiphenylamine |
| 2-NITRO-5-BROMOBENZOTRIFLUORIDE |
| 4-nitro-3-trifluoromethylbromobenzene |
| (4-Nitro-phenyl)-(3-trifluormethyl-phenyl)-amin |