(tetrachloro-1,3-phenylene)bismethylene diacrylate structure
|
Common Name | (tetrachloro-1,3-phenylene)bismethylene diacrylate | ||
|---|---|---|---|---|
| CAS Number | 36904-99-1 | Molecular Weight | 384.03900 | |
| Density | 1.443g/cm3 | Boiling Point | 433.5ºC at 760mmHg | |
| Molecular Formula | C14H10Cl4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.6ºC | |
| Name | [2,3,4,6-tetrachloro-5-(prop-2-enoyloxymethyl)phenyl]methyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760mmHg |
| Molecular Formula | C14H10Cl4O4 |
| Molecular Weight | 384.03900 |
| Flash Point | 160.6ºC |
| Exact Mass | 381.93300 |
| PSA | 52.60000 |
| LogP | 4.75860 |
| Index of Refraction | 1.563 |
| InChIKey | ZHRMOJZUBUMONY-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCc1c(Cl)c(Cl)c(Cl)c(COC(=O)C=C)c1Cl |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Tetrachlor-m-xylylen-diacrylat |
| EINECS 253-267-2 |
| (2,4,5,6-tetrachlorobenzene-1,3-diyl)dimethanediyl bisprop-2-enoate |
| 2,4,5,6-Tetrachlorobenzene-1,3-dimethanoldiacrylate |
| (tetrachloro-1,3-phenylene)bismethylene diacrylate |
| 2-Propenoic acid,(2,4,5,6-tetrachloro-1,3-phenylene)bis(methylene) ester (9CI) |