5-Methoxy-4-phenyl-2H-1-benzopyran-2-one
5-Methoxy-4-phenyl-2H-1-benzopyran-2-one structure
|
Common Name | 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 36914-76-8 | Molecular Weight | 252.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one (CAS number: 36914-76-8, molecular formula: C16H12O3, molecular weight: 252.26500), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12O3 |
|---|---|
| Molecular Weight | 252.26500 |
| Exact Mass | 252.07900 |
| PSA | 39.44000 |
| LogP | 3.46860 |
| InChIKey | GHZPHMZVYPAZSF-UHFFFAOYSA-N |
| SMILES | COc1cccc2oc(=O)cc(-c3ccccc3)c12 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Methoxy-4-phenyl-cumarin |
| 5-methoxy-4-phenyl-chromen-2-one |
| 5-methoxy-4-phenyl-coumarin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: Molecular weight of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is 252.26500. |
| Q: What is the English name of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: The English name of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one. |
| Q: What is the LogP of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: LogP of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is 3.46860. |
| Q: What is the molecular formula of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: Molecular formula of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is C16H12O3. |
| Q: What is the InChIKey of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: InChIKey of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is GHZPHMZVYPAZSF-UHFFFAOYSA-N. |
| Q: What English synonyms does 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one have? |
| A: English synonyms of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one: 5-Methoxy-4-phenyl-cumarin, 5-methoxy-4-phenyl-chromen-2-one, 5-methoxy-4-phenyl-coumarin. |
| Q: What is the SMILES notation of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: SMILES notation of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is COc1cccc2oc(=O)cc(-c3ccccc3)c12. |
| Q: What is the Chinese name of 36914-76-8? |
| A: Chinese name of 36914-76-8 is 36914-76-8. |
| Q: What is the polar surface area (PSA) of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: Polar surface area (PSA) of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is 39.44000. |
| Q: What is the CAS number of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one? |
| A: CAS number of 5-Methoxy-4-phenyl-2H-1-benzopyran-2-one is 36914-76-8. |