pentafluorophenyl chloroformate
pentafluorophenyl chloroformate structure
|
Common Name | pentafluorophenyl chloroformate | ||
|---|---|---|---|---|
| CAS Number | 36919-02-5 | Molecular Weight | 246.51900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7ClF5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: pentafluorophenyl chloroformate (CAS number 36919-02-5, molecular formula C7ClF5O2, molecular weight 246.51900) is for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | pentafluorophenyl chloroformate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7ClF5O2 |
|---|---|
| Molecular Weight | 246.51900 |
| Exact Mass | 245.95100 |
| PSA | 26.30000 |
| LogP | 3.11970 |
| InChIKey | PQBYMIGEEFVPNG-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Oc1c(F)c(F)c(F)c(F)c1F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Chlorameisensaeure-(2,3,4,5,6-pentafluorphenyl)ether |
| Pentafluorophenyl chloroformate |
| Pentafluorphenoxycarbonylchlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of pentafluorophenyl chloroformate? |
| A: CAS number of pentafluorophenyl chloroformate is 36919-02-5. |
| Q: What is the English name of pentafluorophenyl chloroformate? |
| A: The English name of pentafluorophenyl chloroformate is pentafluorophenyl chloroformate. |
| Q: What is the InChIKey of pentafluorophenyl chloroformate? |
| A: InChIKey of pentafluorophenyl chloroformate is PQBYMIGEEFVPNG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of pentafluorophenyl chloroformate? |
| A: Molecular weight of pentafluorophenyl chloroformate is 246.51900. |
| Q: What is the LogP of pentafluorophenyl chloroformate? |
| A: LogP of pentafluorophenyl chloroformate is 3.11970. |
| Q: What is the molecular formula of pentafluorophenyl chloroformate? |
| A: Molecular formula of pentafluorophenyl chloroformate is C7ClF5O2. |
| Q: What English synonyms does pentafluorophenyl chloroformate have? |
| A: English synonyms of pentafluorophenyl chloroformate: Chlorameisensaeure-(2,3,4,5,6-pentafluorphenyl)ether, Pentafluorophenyl chloroformate, Pentafluorphenoxycarbonylchlorid. |
| Q: What is the SMILES notation of pentafluorophenyl chloroformate? |
| A: SMILES notation of pentafluorophenyl chloroformate is O=C(Cl)Oc1c(F)c(F)c(F)c(F)c1F. |
| Q: What is the polar surface area (PSA) of pentafluorophenyl chloroformate? |
| A: Polar surface area (PSA) of pentafluorophenyl chloroformate is 26.30000. |
| Q: What is the Chinese name of 36919-02-5? |
| A: Chinese name of 36919-02-5 is 36919-02-5. |