Thiohexamide structure
|
Common Name | Thiohexamide | ||
|---|---|---|---|---|
| CAS Number | 3692-44-2 | Molecular Weight | 328.45000 | |
| Density | 1.32 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyclohexyl-3-(4-methylsulfanylphenyl)sulfonylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 g/cm3 |
|---|---|
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.45000 |
| Exact Mass | 328.09200 |
| PSA | 108.95000 |
| LogP | 4.59170 |
| Index of Refraction | 1.608 |
| InChIKey | NTCZDZHUBMLJQS-UHFFFAOYSA-N |
| SMILES | CSc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
Thiohexamide CAS#:3692-44-2 |
| Literature: Marshall; Sigal Journal of Organic Chemistry, 1958 , vol. 32, p. 927 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Thiohexamide [INN] |
| N-Cyclohexyl-N'-(4-methylmercapto-benzolsulfonyl)-harnstoff |
| Thiohexamide |
| 1-Cyclohexyl-3-(p-(methylthio)phenylsulfonyl)urea |
| UNII-6M8CV4TKXL |
| N-cyclohexyl-N'-(4-methylsulfanyl-benzenesulfonyl)-urea |