diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate
diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate structure
|
Common Name | diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 36923-19-0 | Molecular Weight | 484.56600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H24N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate, Chinese name: 未提供；CAS number: 36923-19-0；molecular formula: C28H24N2O4S；molecular weight: 484.56600。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H24N2O4S |
|---|---|
| Molecular Weight | 484.56600 |
| Exact Mass | 484.14600 |
| PSA | 101.01000 |
| LogP | 4.17450 |
| InChIKey | WLBRAOUZRDZACO-SHQCIBLASA-N |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=CCSC12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:36923-17-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| norcephalosporin |
| (6R)-8-oxo-7t-(2-phenyl-acetylamino)-(6rH)-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid benzhydryl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: Molecular formula of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate is C28H24N2O4S. |
| Q: What is the LogP of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: LogP of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate is 4.17450. |
| Q: What is the SMILES notation of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: SMILES notation of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate is O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=CCSC12. |
| Q: What is the CAS number of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: CAS number of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate is 36923-19-0. |
| Q: What is the molecular weight of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: Molecular weight of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate is 484.56600. |
| Q: What is the polar surface area (PSA) of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: Polar surface area (PSA) of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate is 101.01000. |
| Q: What is the Chinese name of 36923-19-0? |
| A: Chinese name of 36923-19-0 is 36923-19-0. |
| Q: What is the InChIKey of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: InChIKey of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate is WLBRAOUZRDZACO-SHQCIBLASA-N. |
| Q: What English synonyms does diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate have? |
| A: English synonyms of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate: norcephalosporin, (6R)-8-oxo-7t-(2-phenyl-acetylamino)-(6rH)-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid benzhydryl ester. |
| Q: What are the downstream products of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate? |
| A: Related downstream products(CAS) of diphenylmethyl (6R,7R)-7-(phenylacetamido)ceph-3-em-4-carboxylate: 36923-17-8. |