ethyl 2-(4-aminophenyl)-2-methylpropionate
ethyl 2-(4-aminophenyl)-2-methylpropionate structure
|
Common Name | ethyl 2-(4-aminophenyl)-2-methylpropionate | ||
|---|---|---|---|---|
| CAS Number | 36924-81-9 | Molecular Weight | 207.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 2-(4-aminophenyl)-2-methylpropionate, Chinese name: 乙基(4-氨基苯基)-2-甲基丙酸酯, CAS number: 36924-81-9, molecular formula: C12H17NO2, molecular weight: 207.26900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(4-aminophenyl)-2-methylpropionate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17NO2 |
|---|---|
| Molecular Weight | 207.26900 |
| Exact Mass | 207.12600 |
| PSA | 52.32000 |
| LogP | 2.69070 |
| InChIKey | QLWOMLYAERSUKT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)c1ccc(N)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:18755-56-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(4-amino-phenyl)-2-methyl-propionic acid ethyl ester |
| ethyl (4-aminophenyl)-2,2-dimethylacetate |
| ethyl α-(4-aminophenyl)-isobutyrate |
| 2-(4-Amino-phenyl)-2-methyl-propionsaeure-aethylester |
| ethyl 2-methyl-2-(4'-aminophenyl)propionate |
| Ethyl 2-(4-aminophenyl)-2-methylpropionate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: Polar surface area (PSA) of ethyl 2-(4-aminophenyl)-2-methylpropionate is 52.32000. |
| Q: What are the downstream products of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: Related downstream products(CAS) of ethyl 2-(4-aminophenyl)-2-methylpropionate: 18755-56-1. |
| Q: What is the molecular formula of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: Molecular formula of ethyl 2-(4-aminophenyl)-2-methylpropionate is C12H17NO2. |
| Q: What is the SMILES notation of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: SMILES notation of ethyl 2-(4-aminophenyl)-2-methylpropionate is CCOC(=O)C(C)(C)c1ccc(N)cc1. |
| Q: What is the Chinese name of 36924-81-9? |
| A: Chinese name of 36924-81-9 is 36924-81-9. |
| Q: What is the CAS number of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: CAS number of ethyl 2-(4-aminophenyl)-2-methylpropionate is 36924-81-9. |
| Q: What is the LogP of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: LogP of ethyl 2-(4-aminophenyl)-2-methylpropionate is 2.69070. |
| Q: What is the molecular weight of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: Molecular weight of ethyl 2-(4-aminophenyl)-2-methylpropionate is 207.26900. |
| Q: What English synonyms does ethyl 2-(4-aminophenyl)-2-methylpropionate have? |
| A: English synonyms of ethyl 2-(4-aminophenyl)-2-methylpropionate: 2-(4-amino-phenyl)-2-methyl-propionic acid ethyl ester, ethyl (4-aminophenyl)-2,2-dimethylacetate, ethyl α-(4-aminophenyl)-isobutyrate, 2-(4-Amino-phenyl)-2-methyl-propionsaeure-aethylester, ethyl 2-methyl-2-(4'-aminophenyl)propionate, Ethyl 2-(4-aminophenyl)-2-methylpropionate. |
| Q: What is the English name of ethyl 2-(4-aminophenyl)-2-methylpropionate? |
| A: The English name of ethyl 2-(4-aminophenyl)-2-methylpropionate is ethyl 2-(4-aminophenyl)-2-methylpropionate. |