1-nitroanthraquinone
1-nitroanthraquinone structure
|
Common Name | 1-nitroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 36925-31-2 | Molecular Weight | 223.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Nitroanthraquinone (Chinese name: 1-硝基蒽醌, CAS number: 36925-31-2, molecular formula: C14H9NO2, molecular weight: 223.22700), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-nitroanthraquinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9NO2 |
|---|---|
| Molecular Weight | 223.22700 |
| Exact Mass | 223.06300 |
| PSA | 45.82000 |
| LogP | 4.42440 |
| InChIKey | JBDYKGMNMDIHFL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2cc3ccccc3cc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:82-34-8
CAS#:610-49-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| nitroanthracene |
| 1-nitro-anthracene |
| 1-Nitro-anthracen |
| 1-Nitroanthracene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-nitroanthraquinone have? |
| A: English synonyms of 1-nitroanthraquinone: nitroanthracene, 1-nitro-anthracene, 1-Nitro-anthracen, 1-Nitroanthracene. |
| Q: What is the molecular formula of 1-nitroanthraquinone? |
| A: Molecular formula of 1-nitroanthraquinone is C14H9NO2. |
| Q: What is the English name of 1-nitroanthraquinone? |
| A: The English name of 1-nitroanthraquinone is 1-nitroanthraquinone. |
| Q: What is the CAS number of 1-nitroanthraquinone? |
| A: CAS number of 1-nitroanthraquinone is 36925-31-2. |
| Q: What is the molecular weight of 1-nitroanthraquinone? |
| A: Molecular weight of 1-nitroanthraquinone is 223.22700. |
| Q: What is the polar surface area (PSA) of 1-nitroanthraquinone? |
| A: Polar surface area (PSA) of 1-nitroanthraquinone is 45.82000. |
| Q: What are the downstream products of 1-nitroanthraquinone? |
| A: Related downstream products(CAS) of 1-nitroanthraquinone: 82-34-8;610-49-1. |
| Q: What is the Chinese name of 36925-31-2? |
| A: Chinese name of 36925-31-2 is 36925-31-2. |
| Q: What is the LogP of 1-nitroanthraquinone? |
| A: LogP of 1-nitroanthraquinone is 4.42440. |
| Q: What is the InChIKey of 1-nitroanthraquinone? |
| A: InChIKey of 1-nitroanthraquinone is JBDYKGMNMDIHFL-UHFFFAOYSA-N. |