[2-(piperidine-1-carbonyl)phenyl] acetate structure
|
Common Name | [2-(piperidine-1-carbonyl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 36930-87-7 | Molecular Weight | 247.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(piperidine-1-carbonyl)phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17NO3 |
|---|---|
| Molecular Weight | 247.29000 |
| Exact Mass | 247.12100 |
| PSA | 46.61000 |
| LogP | 2.17590 |
| InChIKey | UCRSPXNTYLWPNX-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C(=O)N1CCCCC1 |
|
~%
[2-(piperidine-... CAS#:36930-87-7 |
| Literature: Tomisek Journal of the American Chemical Society, 1948 , vol. 70, p. 2609 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Piperidine,1-[2-(acetyloxy)benzoyl] |
| 1-(2-acetoxy-benzoyl)-piperidine |