Abiesadine Q structure
|
Common Name | Abiesadine Q | ||
|---|---|---|---|---|
| CAS Number | 369364-79-4 | Molecular Weight | 400.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Abiesadine QAbiesadine Q (compound 17) is a diterpene compound that can be isolated from the aboveground parts of Abies georgei Orr[1]. |
| Name | Abiesadine Q |
|---|
| Description | Abiesadine Q (compound 17) is a diterpene compound that can be isolated from the aboveground parts of Abies georgei Orr[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H32O5 |
|---|---|
| Molecular Weight | 400.51 |
| InChIKey | ZSHVSBCOLVBOLB-NKKJXINNSA-N |
| SMILES | CC(C)c1ccc2c(c1)C(=O)CC1C(C)(COC(=O)CCC(=O)O)CCCC21C |