5-((4-Chlorophenyl)(piperidin-1-yl)methyl)-2-methylthiazolo[3,2-b][1,2,4]triazol-6-ol structure
|
Common Name | 5-((4-Chlorophenyl)(piperidin-1-yl)methyl)-2-methylthiazolo[3,2-b][1,2,4]triazol-6-ol | ||
|---|---|---|---|---|
| CAS Number | 369367-02-2 | Molecular Weight | 362.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19ClN4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-((4-Chlorophenyl)(piperidin-1-yl)methyl)-2-methylthiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|
| Molecular Formula | C17H19ClN4OS |
|---|---|
| Molecular Weight | 362.9 |
| InChIKey | CJCQSWIOOXJXCI-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C(SC2=N1)C(C3=CC=C(C=C3)Cl)N4CCCCC4)O |
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|