Sarcotin B
Modify Date: 2026-06-28 18:54:08
Sarcotin B structure
|
Common Name | Sarcotin B | ||
|---|---|---|---|---|
| CAS Number | 369367-32-8 | Molecular Weight | 398.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sarcotin B |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H34O4 |
|---|---|
| Molecular Weight | 398.5 |
| InChIKey | UXFNAATUJSSAHF-NWSWWEOTSA-N |
| SMILES | CC1=C([C@@H](OC1=O)C/C(=C\CCC(C)/C=C\C=C(\C)/CCCC2=COC=C2)/C)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human HCT15 cells
Source: ChEMBL
Target: HCT-15
External Id: CHEMBL945504
|
|
Name: Cytotoxicity against human SK-MEL-2 cells
Source: ChEMBL
Target: SK-MEL-2
External Id: CHEMBL946524
|
|
Name: Cytotoxicity against human SKOV3 cells
Source: ChEMBL
Target: SK-OV-3
External Id: CHEMBL942445
|
Total 5, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Sarcotin B? |
| A: Molecular weight of Sarcotin B is 398.5. |
| Q: What is the SMILES notation of Sarcotin B? |
| A: SMILES notation of Sarcotin B is CC1=C([C@@H](OC1=O)C/C(=C\CCC(C)/C=C\C=C(\C)/CCCC2=COC=C2)/C)O. |
| Q: What is the molecular formula of Sarcotin B? |
| A: Molecular formula of Sarcotin B is C25H34O4. |
| Q: What is the Chinese name of 369367-32-8? |
| A: Chinese name of 369367-32-8 is 369367-32-8. |
| Q: What is the English name of Sarcotin B? |
| A: The English name of Sarcotin B is Sarcotin B. |
| Q: What is the InChIKey of Sarcotin B? |
| A: InChIKey of Sarcotin B is UXFNAATUJSSAHF-NWSWWEOTSA-N. |
| Q: What is the CAS number of Sarcotin B? |
| A: CAS number of Sarcotin B is 369367-32-8. |