2-(4-Biphenylyl)-2-(Boc-amino)acetic Acid structure
|
Common Name | 2-(4-Biphenylyl)-2-(Boc-amino)acetic Acid | ||
|---|---|---|---|---|
| CAS Number | 369403-44-1 | Molecular Weight | 327.374 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 512.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7±30.1 °C | |
| Name | 4-Biphenylyl({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic aci d |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 512.4±50.0 °C at 760 mmHg |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.374 |
| Flash Point | 263.7±30.1 °C |
| Exact Mass | 327.147064 |
| PSA | 79.12000 |
| LogP | 4.50 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | IGQRMCQSKDTFDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Biphenylyl({[(2-methyl-2-propanyl)oxy]carbonyl}amino)acetic acid |
| [1,1'-Biphenyl]-4-acetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]- |