4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole
Modify Date: 2026-06-25 15:44:40
![4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole Structure](https://www.chemsrc.com/extcaspic/142/36941-40-9.png)
4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole structure
|
Common Name | 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 36941-40-9 | Molecular Weight | 377.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H16ClN3S |
|---|---|
| Molecular Weight | 377.9 |
| InChIKey | RQZFRMOIDYEMKM-OYKKKHCWSA-N |
| SMILES | C/C(=N/NC1=NC(=CS1)C2=CC=C(C=C2)Cl)/C3=CC4=CC=CC=C4C=C3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of recombinant human p300 catalytic domain (1284 to 1673 aa) using histone...
Source: ChEMBL
Target: Histone acetyltransferase p300
External Id: CHEMBL3269130
|
|
Name: Inhibition of recombinant human PCAF catalytic domain (492 to 658 aa) using histone H...
Source: ChEMBL
Target: Histone acetyltransferase KAT2B
External Id: CHEMBL3269133
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 36941-40-9? |
| A: Chinese name of 36941-40-9 is 36941-40-9. |
| Q: What is the InChIKey of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole? |
| A: InChIKey of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole is RQZFRMOIDYEMKM-OYKKKHCWSA-N. |
| Q: What is the SMILES notation of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole? |
| A: SMILES notation of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole is C/C(=N/NC1=NC(=CS1)C2=CC=C(C=C2)Cl)/C3=CC4=CC=CC=C4C=C3. |
| Q: What is the English name of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole? |
| A: The English name of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole is 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole. |
| Q: What is the molecular formula of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole? |
| A: Molecular formula of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole is C21H16ClN3S. |
| Q: What is the molecular weight of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole? |
| A: Molecular weight of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole is 377.9. |
| Q: What is the CAS number of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole? |
| A: CAS number of 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole is 36941-40-9. |