4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole structure
|
Common Name | 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 36941-40-9 | Molecular Weight | 377.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-chlorophenyl)-2-[(Z)-2-[1-(naphthalen-2-yl)ethylidene]hydrazin-1-yl]-1,3-thiazole |
|---|
| Molecular Formula | C21H16ClN3S |
|---|---|
| Molecular Weight | 377.9 |
| InChIKey | RQZFRMOIDYEMKM-OYKKKHCWSA-N |
| SMILES | C/C(=N/NC1=NC(=CS1)C2=CC=C(C=C2)Cl)/C3=CC4=CC=CC=C4C=C3 |
|
Name: Inhibition of recombinant human p300 catalytic domain (1284 to 1673 aa) using histone...
Source: ChEMBL
Target: Histone acetyltransferase p300
External Id: CHEMBL3269130
|
|
Name: Inhibition of recombinant human PCAF catalytic domain (492 to 658 aa) using histone H...
Source: ChEMBL
Target: Histone acetyltransferase KAT2B
External Id: CHEMBL3269133
|